Products 279261-82-4
CAS 279261-82-4 appears in our catalog under these names: 4-Ethoxy-2-fluorophenylboronic acid, 98%, (4-Ethoxy-2-fluorophenyl)boronic acid 98%, (4-Ethoxy-2-fluorophenyl)boronic acid, 97%, Boronic acid, B-(4-ethoxy-2-fluorophenyl)-, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 10g, 100mg.
(4-ethoxy-2-fluorophenyl)boronic acid (CAS 279261-82-4) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: (4-ethoxy-2-fluorophenyl)boronic acid. InChIKey: OPBZIEMMNXUXAK-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | (4-ethoxy-2-fluorophenyl)boronic acid |
| InChIKey | OPBZIEMMNXUXAK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC)F)(O)O |
Computed by PubChem (NCBI)