CAS 1239591-04-8 appears in our catalog under these names: 3-Fluoro-2-methoxy-4-methylphenyl phenylboronic acid, 95%, (3-Fluoro-2-methoxy-4-methylphenyl)boronic acid 95%, (3'-Fluoro-2'-methoxy-4'-methyl-[1,1'-biphenyl]-2-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
(3-fluoro-2-methoxy-4-methylphenyl)boronic acid (CAS 1239591-04-8) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: (3-fluoro-2-methoxy-4-methylphenyl)boronic acid. InChIKey: POJOYDYAJWEBMY-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | (3-fluoro-2-methoxy-4-methylphenyl)boronic acid |
| InChIKey | POJOYDYAJWEBMY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C)F)OC)(O)O |
Computed by PubChem (NCBI)