cas: 881402-25-1 — see every product listed under this CAS number, including other names
(2-Fluoro-3-(trifluoromethoxy)phenyl)boronic acid, 95% (CAS 881402-25-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A466306-25g |
| cas | 881402-25-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 10225.60 Pln | |
| AmBeed | 10g | 5147.80 Pln | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 1g | 976.76 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-fluoro-3-(trifluoromethoxy)phenyl]boronic acid (CAS 881402-25-1) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [2-fluoro-3-(trifluoromethoxy)phenyl]boronic acid. InChIKey: YVAHUXRWGTUGJO-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [2-fluoro-3-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | YVAHUXRWGTUGJO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)