CAS 915401-97-7 appears in our catalog under these names: 3,5-Difluoro-4-difluoromethoxy-benzeneboronic acid, 98%, (4-(Difluoromethoxy)-3,5-difluorophenyl)boronic acid 98%, (4-(Difluoromethoxy)-3,5-difluorophenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g.
[4-(difluoromethoxy)-3,5-difluorophenyl]boronic acid (CAS 915401-97-7) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [4-(difluoromethoxy)-3,5-difluorophenyl]boronic acid. InChIKey: MMZMGLLJCWTMAV-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [4-(difluoromethoxy)-3,5-difluorophenyl]boronic acid |
| InChIKey | MMZMGLLJCWTMAV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC(F)F)F)(O)O |
Computed by PubChem (NCBI)