CAS 187804-79-1 appears in our catalog under these names: 3-Fluoro-4-(trifluoromethoxy)phenylboronic acid, 97%, (3-Fluoro-4-(trifluoromethoxy)phenyl)boronic acid, 95-<97%, (3-Fluoro-4-(trifluoromethoxy)phenyl)boronic acid, ≥97-<99%, 3-Fluoro-4-(trifluoromethoxy)phenylboronic acid, (3–Fluoro–4–(trifluoromethoxy)phenyl)boronic acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC, GLPBio, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g, 200g, 300g.
[3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid (CAS 187804-79-1) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: VDEVIIGZNWVCOR-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | VDEVIIGZNWVCOR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)