CAS 871126-20-4 is the registry number for 4-Methoxy-2,3,5,6-tetrafluorophenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,3,5,6-tetrafluoro-4-methoxyphenyl)boronic acid (CAS 871126-20-4) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: (2,3,5,6-tetrafluoro-4-methoxyphenyl)boronic acid. InChIKey: AVCUUTFGJGZDMS-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | (2,3,5,6-tetrafluoro-4-methoxyphenyl)boronic acid |
| InChIKey | AVCUUTFGJGZDMS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)OC)F)F)(O)O |
Computed by PubChem (NCBI)