Products 1628442-69-2
CAS 1628442-69-2 is the registry number for (4-(Difluoromethoxy)-2,5-difluorophenyl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
[4-(difluoromethoxy)-2,5-difluorophenyl]boronic acid (CAS 1628442-69-2) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [4-(difluoromethoxy)-2,5-difluorophenyl]boronic acid. InChIKey: DPFPMZHXDKOKSD-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [4-(difluoromethoxy)-2,5-difluorophenyl]boronic acid |
| InChIKey | DPFPMZHXDKOKSD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OC(F)F)F)(O)O |
Computed by PubChem (NCBI)