cas: 1331945-14-2 — see every product listed under this CAS number, including other names
(2-Fluoro-4-(hydroxymethyl)phenyl)boronic acid, 95% (CAS 1331945-14-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614765-1G |
| cas | 1331945-14-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1455.76 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[2-fluoro-4-(hydroxymethyl)phenyl]boronic acid (CAS 1331945-14-2) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [2-fluoro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: YPJXLOUZOVHAIZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [2-fluoro-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | YPJXLOUZOVHAIZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)CO)F)(O)O |
Computed by PubChem (NCBI)