Products 406482-19-7
CAS 406482-19-7 appears in our catalog under these names: 2–Fluoro–5–methoxyphenylboronic acid, (2-Fluoro-5-methoxyphenyl)boronic Acid (contains varying amounts of Anhydride), 2-Fluoro-5-methoxyphenylboronic acid 98%, 2-Fluoro-5-methoxyphenylboronic acid, 98%, 98%, 2-Fluoro-5-methoxyphenylboronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g, 100g, 50g.
(2-fluoro-5-methoxyphenyl)boronic acid (CAS 406482-19-7) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: (2-fluoro-5-methoxyphenyl)boronic acid. InChIKey: IPTZOWYBCLEBOE-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | (2-fluoro-5-methoxyphenyl)boronic acid |
| InChIKey | IPTZOWYBCLEBOE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-5-methoxyphenylboronic acid, (2-fluoro-5-methoxyphenyl)boronic acid, (2-fluoro-5-methoxy-phenyl)boronic Acid, 2-fluoro-5met, 2-fluoro-5methoxyphenylboronic acid, 5-methoxy-2-fluorophenylboronic acid, 2-fluoro-5-methoxy-phenylboronic acid, 2-fluoro-5-methoxyphenyl boronic acid, B-(2-Fluoro-5-methoxyphenyl)boronic acid, 2-Fluoro-5-methoxybenzeneboronic acid, 97%