cas: 874289-23-3 — see every product listed under this CAS number, including other names
(2-Fluoro-4-(methylcarbamoyl)phenyl)boronic acid, 98% (CAS 874289-23-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A397134-5g |
| cas | 874289-23-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7178.92 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1158.98 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-fluoro-4-(methylcarbamoyl)phenyl]boronic acid (CAS 874289-23-3) is a chemical compound with the molecular formula C8H9BFNO3 and a molecular weight of 196.97 g/mol. IUPAC name: [2-fluoro-4-(methylcarbamoyl)phenyl]boronic acid. InChIKey: STYRVOIKGOQNAD-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO3 |
|---|---|
| Molecular weight | 196.97 g/mol |
| IUPAC name | [2-fluoro-4-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | STYRVOIKGOQNAD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)NC)F)(O)O |
Computed by PubChem (NCBI)