CAS 626251-12-5 appears in our catalog under these names: 4-acetamido-3-fluorophenylboronic acid, 95%, 4-Acetamido-3-fluorophenylboronic Acid 95+%, 4-Acetamido-3-fluorophenylboronic Acid, 95+%, 95+%, (4-Acetamido-3-fluorophenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(4-acetamido-3-fluorophenyl)boronic acid (CAS 626251-12-5) is a chemical compound with the molecular formula C8H9BFNO3 and a molecular weight of 196.97 g/mol. IUPAC name: (4-acetamido-3-fluorophenyl)boronic acid. InChIKey: RSBBBRALHOPKCM-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO3 |
|---|---|
| Molecular weight | 196.97 g/mol |
| IUPAC name | (4-acetamido-3-fluorophenyl)boronic acid |
| InChIKey | RSBBBRALHOPKCM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)NC(=O)C)F)(O)O |
Computed by PubChem (NCBI)