Products 1701449-28-6
CAS 1701449-28-6 is the registry number for 8-Fluoro-2,3-dihydro-1,4-benzoxazine-6-boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(8-fluoro-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid (CAS 1701449-28-6) is a chemical compound with the molecular formula C8H9BFNO3 and a molecular weight of 196.97 g/mol. IUPAC name: (8-fluoro-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid. InChIKey: WDQWWPUHGOOVME-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO3 |
|---|---|
| Molecular weight | 196.97 g/mol |
| IUPAC name | (8-fluoro-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid |
| InChIKey | WDQWWPUHGOOVME-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C(=C1)F)OCCN2)(O)O |
Computed by PubChem (NCBI)