Products 2096331-00-7
CAS 2096331-00-7 appears in our catalog under these names: 2-Fluoro-3-(methylcarbamoyl)phenylboronic acid, 98%, (2-Fluoro-3-(methylcarbamoyl)phenyl)boronic acid 97%, (2-Fluoro-3-(methylcarbamoyl)phenyl)boronic acid, 97%, 97%, 2-Fluoro-3-(methylcarbamoyl)phenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
[2-fluoro-3-(methylcarbamoyl)phenyl]boronic acid (CAS 2096331-00-7) is a chemical compound with the molecular formula C8H9BFNO3 and a molecular weight of 196.97 g/mol. IUPAC name: [2-fluoro-3-(methylcarbamoyl)phenyl]boronic acid. InChIKey: YAILSJPZRGIKHD-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO3 |
|---|---|
| Molecular weight | 196.97 g/mol |
| IUPAC name | [2-fluoro-3-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | YAILSJPZRGIKHD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)NC)F)(O)O |
Computed by PubChem (NCBI)