CAS 874289-23-3 appears in our catalog under these names: 2-fluoro-4-(methylcarbamoyl)phenylboronic acid, 98%, (2-Fluoro-4-(methylcarbamoyl)phenyl)boronic acid, 98%, (2–Fluoro–4–(methylcarbamoyl)phenyl)boronic acid, (2-Fluoro-4-(methylcarbamoyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
[2-fluoro-4-(methylcarbamoyl)phenyl]boronic acid (CAS 874289-23-3) is a chemical compound with the molecular formula C8H9BFNO3 and a molecular weight of 196.97 g/mol. IUPAC name: [2-fluoro-4-(methylcarbamoyl)phenyl]boronic acid. InChIKey: STYRVOIKGOQNAD-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO3 |
|---|---|
| Molecular weight | 196.97 g/mol |
| IUPAC name | [2-fluoro-4-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | STYRVOIKGOQNAD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)NC)F)(O)O |
Computed by PubChem (NCBI)