(2-Fluoro-4-(trifluoromethoxy)phenyl)boronic acid, 98%
cas: 503309-10-2 — see every product listed under this CAS number, including other names
(2-Fluoro-4-(trifluoromethoxy)phenyl)boronic acid, 98% (CAS 503309-10-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A449853-250mg |
| cas | 503309-10-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 2417.38 Pln | |
| Ambeed | 10g | 4764.75 Pln | |
| BLDpharm | 100mg | 258.82 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 791.97 Pln | |
| BLDpharm | 5g | 2602.44 Pln | |
| BLDpharm | 10g | 5129.33 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 5g | 2491.85 Pln | |
| Fluorochem | 10g | 4871.22 Pln | |
| Fluorochem | 100mg | 242.64 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[2-fluoro-4-(trifluoromethoxy)phenyl]boronic acid (CAS 503309-10-2) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [2-fluoro-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: YQMMVZVQAHYXFZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [2-fluoro-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | YQMMVZVQAHYXFZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Fluoro-4-(trifluoromethoxy)phenyl)boronic acid, [2-Fluoro-4-(trifluoromethoxy)phenyl]boronic acid, 2-Fluoro-4-trifluoromethoxybenzeneboronic Acid, 2-Fluoro-4-(trifluoromethoxy)benzeneboronic acid, Boronic acid, [2-fluoro-4-(trifluoromethoxy)phenyl]-, 4-trifluoromethoxy-2-fluorophenylboronic acid, 2-Fluoro-4-trifluoromethoxyphenyl boronic acid, (2-Fluoro-4-(trifluoromethoxy)phenyl)boronicacid, Boronic acid, [2-fluoro-4-(trifluoromethoxy)phenyl