cas: 874289-40-4 — see every product listed under this CAS number, including other names
(2-Fluoro-5-(methylcarbamoyl)phenyl)boronic acid, 98% (CAS 874289-40-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319666-250MG |
| cas | 874289-40-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 950.72 Pln | |
| Fluorochem | 10g | 1820.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2-fluoro-5-(methylcarbamoyl)phenyl]boronic acid (CAS 874289-40-4) is a chemical compound with the molecular formula C8H9BFNO3 and a molecular weight of 196.97 g/mol. IUPAC name: [2-fluoro-5-(methylcarbamoyl)phenyl]boronic acid. InChIKey: YOQRSSHEHKHAGS-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO3 |
|---|---|
| Molecular weight | 196.97 g/mol |
| IUPAC name | [2-fluoro-5-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | YOQRSSHEHKHAGS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NC)F)(O)O |
Computed by PubChem (NCBI)