cas: 24974-71-8 — see every product listed under this CAS number, including other names
(2-Fluorophenyl)methanesulfonyl chloride 95% (CAS 24974-71-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A211740-250mg |
| cas | 24974-71-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1054.56 Pln | |
| Ambeed | 10g | 1594.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A211740 |
(2-fluorophenyl)methanesulfonyl chloride (CAS 24974-71-8) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: (2-fluorophenyl)methanesulfonyl chloride. InChIKey: CJDWSUDXKHLMCY-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | (2-fluorophenyl)methanesulfonyl chloride |
| InChIKey | CJDWSUDXKHLMCY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)Cl)F |
Computed by PubChem (NCBI)