Products 1261284-27-8
CAS 1261284-27-8 is the registry number for 4-Chloro-2-fluoro-1-methanesulfonylbenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-chloro-2-fluoro-1-methylsulfonylbenzene (CAS 1261284-27-8) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 4-chloro-2-fluoro-1-methylsulfonylbenzene. InChIKey: HWZSMCSCMSDYFG-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 4-chloro-2-fluoro-1-methylsulfonylbenzene |
| InChIKey | HWZSMCSCMSDYFG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)