CAS 1092349-98-8 appears in our catalog under these names: 2-Fluoro-3-methylbenzenesulfonyl chloride, 95%, 2-Fluoro-3-methylbenzenesulfonyl chloride, 2-Fluoro-3-methylbenzene-1-sulfonyl chloride 98+%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2,5g, 100mg, 10g.
2-fluoro-3-methylbenzenesulfonyl chloride (CAS 1092349-98-8) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 2-fluoro-3-methylbenzenesulfonyl chloride. InChIKey: MQSQFPZVCHUKJH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-fluoro-3-methylbenzenesulfonyl chloride |
| InChIKey | MQSQFPZVCHUKJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)