CAS 847148-17-8 appears in our catalog under these names: 2-Chloro-1-fluoro-4-methylsulfonylbenzene, 98%, 2-Chloro-1-fluoro-4-(methylsulfonyl)benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
2-chloro-1-fluoro-4-methylsulfonylbenzene (CAS 847148-17-8) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 2-chloro-1-fluoro-4-methylsulfonylbenzene. InChIKey: QJUXXQFUEROZHT-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-chloro-1-fluoro-4-methylsulfonylbenzene |
| InChIKey | QJUXXQFUEROZHT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)