Products 875166-92-0

CAS 875166-92-0 appears in our catalog under these names: 3-Fluoro-2-methylbenzenesulfonyl chloride, 97%, 3-Fluoro-2-methylbenzenesulfonylchloride 98%, 3-Fluoro-2-methylbenzenesulfonyl chloride. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-fluoro-2-methylbenzenesulfonyl chloride (CAS 875166-92-0) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 3-fluoro-2-methylbenzenesulfonyl chloride. InChIKey: WKJLXHQGXSWSCK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClFO2S
Molecular weight208.64 g/mol
IUPAC name3-fluoro-2-methylbenzenesulfonyl chloride
InChIKeyWKJLXHQGXSWSCK-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1S(=O)(=O)Cl)F

Computed by PubChem (NCBI)