cas: 870778-88-4 — see every product listed under this CAS number, including other names
(2-Isopropoxy-6-methoxyphenyl)boronic acid 98% (CAS 870778-88-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A236327-1g |
| cas | 870778-88-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 748.62 Pln | |
| Ambeed | 25g | 1405.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A236327 |
(2-methoxy-6-propan-2-yloxyphenyl)boronic acid (CAS 870778-88-4) is a chemical compound with the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. IUPAC name: (2-methoxy-6-propan-2-yloxyphenyl)boronic acid. InChIKey: ZAKDYROLNHVOEL-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | (2-methoxy-6-propan-2-yloxyphenyl)boronic acid |
| InChIKey | ZAKDYROLNHVOEL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1OC(C)C)OC)(O)O |
Computed by PubChem (NCBI)