CAS 1960406-10-3 appears in our catalog under these names: 3-Isopropoxy-5-methoxyphenylboronic acid, 96%, 3-Isopropoxy-5-methoxyphenylboronic acid, 96%, 96%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(3-methoxy-5-propan-2-yloxyphenyl)boronic acid (CAS 1960406-10-3) is a chemical compound with the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. IUPAC name: (3-methoxy-5-propan-2-yloxyphenyl)boronic acid. InChIKey: VHBYYKMZGKTMAW-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | (3-methoxy-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | VHBYYKMZGKTMAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC(C)C)OC)(O)O |
Computed by PubChem (NCBI)