CAS 875654-33-4 appears in our catalog under these names: 4-Isopropoxy-3-methoxyphenylboronic acid, 4-Isopropoxy-3-methoxyphenylboronic acid, 95%, 4-Isopropoxy-3-methoxyphenylboronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg.
(3-methoxy-4-propan-2-yloxyphenyl)boronic acid (CAS 875654-33-4) is a chemical compound with the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. IUPAC name: (3-methoxy-4-propan-2-yloxyphenyl)boronic acid. InChIKey: ZRCWUUPWMVBXSG-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | (3-methoxy-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | ZRCWUUPWMVBXSG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(C)C)OC)(O)O |
Computed by PubChem (NCBI)