CAS 1451392-24-7 appears in our catalog under these names: 2,3-Dimethyl-4-(methoxymethoxy)phenylboronic acid, 95%, 2,3-Dimethyl-4-(methoxymethoxy)phenylboronic acid, ≥95%, ≥95%, 2,3-Dimethyl-4-(methoxymethoxy)phenylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[4-(methoxymethoxy)-2,3-dimethylphenyl]boronic acid (CAS 1451392-24-7) is a chemical compound with the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. IUPAC name: [4-(methoxymethoxy)-2,3-dimethylphenyl]boronic acid. InChIKey: MTUFCHIWJUFOOZ-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | [4-(methoxymethoxy)-2,3-dimethylphenyl]boronic acid |
| InChIKey | MTUFCHIWJUFOOZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCOC)C)C)(O)O |
Computed by PubChem (NCBI)