Products 223128-32-3
CAS 223128-32-3 appears in our catalog under these names: 4-(Methoxymethoxy)-3,5-dimethylphenylboronic acid, 96%, (4-(Methoxymethoxy)-3,5-dimethylphenyl)boronic acid 96%, (4-(Methoxymethoxy)-3,5-dimethylphenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
[4-(methoxymethoxy)-3,5-dimethylphenyl]boronic acid (CAS 223128-32-3) is a chemical compound with the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. IUPAC name: [4-(methoxymethoxy)-3,5-dimethylphenyl]boronic acid. InChIKey: STZJZCMYEFOIIR-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | [4-(methoxymethoxy)-3,5-dimethylphenyl]boronic acid |
| InChIKey | STZJZCMYEFOIIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OCOC)C)(O)O |
Computed by PubChem (NCBI)