cas: 100939-98-8 — see every product listed under this CAS number, including other names
(2-METHOXYPHENYL)(PIPERAZIN-1-YL)METHANONE HCL, 95% (CAS 100939-98-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F535632-1G |
| cas | 100939-98-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 25g | 2075.33 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2-methoxyphenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 100939-98-8) is a chemical compound with the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. IUPAC name: (2-methoxyphenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: FGQQUOJYSYJORX-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O2 |
|---|---|
| Molecular weight | 256.73 g/mol |
| IUPAC name | (2-methoxyphenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | FGQQUOJYSYJORX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)