CAS 2702505-05-1 is the registry number for (2-Chloro-6-nitrophenyl)di-n-propylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-chloro-6-nitro-N,N-dipropylaniline (CAS 2702505-05-1) is a chemical compound with the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. IUPAC name: 2-chloro-6-nitro-N,N-dipropylaniline. InChIKey: JRPTWNDAZOPFLK-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O2 |
|---|---|
| Molecular weight | 256.73 g/mol |
| IUPAC name | 2-chloro-6-nitro-N,N-dipropylaniline |
| InChIKey | JRPTWNDAZOPFLK-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C1=C(C=CC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)