Products 1219404-87-1

CAS 1219404-87-1 is the registry number for N-(4-Methoxyphenyl)pyrrolidine-2-carboxamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

N-(4-methoxyphenyl)pyrrolidine-2-carboxamide;hydrochloride (CAS 1219404-87-1) is a chemical compound with the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. IUPAC name: N-(4-methoxyphenyl)pyrrolidine-2-carboxamide;hydrochloride. InChIKey: LIEKBUPUDOGZFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17ClN2O2
Molecular weight256.73 g/mol
IUPAC nameN-(4-methoxyphenyl)pyrrolidine-2-carboxamide;hydrochloride
InChIKeyLIEKBUPUDOGZFZ-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)NC(=O)C2CCCN2.Cl

Computed by PubChem (NCBI)