CAS 40832-47-1 is the registry number for (4-Chloro-2-nitrophenyl)di-n-propylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-chloro-2-nitro-N,N-dipropylaniline (CAS 40832-47-1) is a chemical compound with the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. IUPAC name: 4-chloro-2-nitro-N,N-dipropylaniline. InChIKey: YKIDUFYKCCUAET-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O2 |
|---|---|
| Molecular weight | 256.73 g/mol |
| IUPAC name | 4-chloro-2-nitro-N,N-dipropylaniline |
| InChIKey | YKIDUFYKCCUAET-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C1=C(C=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)