Products 1197232-18-0
CAS 1197232-18-0 appears in our catalog under these names: 4-[(4-Methylpiperazin-1-yl)carbonyl]phenol hydrochloride, 95%, 4-(4-Methylpiperazine-1-carbonyl)phenol hydrochloride, 98%, 4-(4-Methylpiperazine-1-carbonyl)phenol hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 2,5g.
(4-hydroxyphenyl)-(4-methylpiperazin-1-yl)methanone;hydrochloride (CAS 1197232-18-0) is a chemical compound with the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. IUPAC name: (4-hydroxyphenyl)-(4-methylpiperazin-1-yl)methanone;hydrochloride. InChIKey: DGTWBLJYWXWBBO-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O2 |
|---|---|
| Molecular weight | 256.73 g/mol |
| IUPAC name | (4-hydroxyphenyl)-(4-methylpiperazin-1-yl)methanone;hydrochloride |
| InChIKey | DGTWBLJYWXWBBO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC=C(C=C2)O.Cl |
Computed by PubChem (NCBI)