cas: 1137339-95-7 — see every product listed under this CAS number, including other names
(2-Methoxy-5-(methylcarbamoyl)phenyl)boronic acid, 98+% (CAS 1137339-95-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A178515-10g |
| cas | 1137339-95-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 30536.80 Pln | |
| AmBeed | 25g | 59903.41 Pln | |
| AmBeed | 5g | 18011.56 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-methoxy-5-(methylcarbamoyl)phenyl]boronic acid (CAS 1137339-95-7) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 209.01 g/mol. IUPAC name: [2-methoxy-5-(methylcarbamoyl)phenyl]boronic acid. InChIKey: KCLKEUZCMVHJLZ-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 209.01 g/mol |
| IUPAC name | [2-methoxy-5-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | KCLKEUZCMVHJLZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NC)OC)(O)O |
Computed by PubChem (NCBI)