Products 111821-49-9
CAS 111821-49-9 appears in our catalog under these names: 4-Borono-D-phenylalanine, >95% (HPLC), (R)–2–Amino–3–(4–boronophenyl)propanoic acid, (R)-2-Amino-3-(4-boronophenyl)propanoic acid 95%, 4-BORONO-D-PHENYLALANINE, >=97.0% HPL&, (R)-2-Amino-3-(4-boronophenyl)propanoic acid, 95%, 95%. Offered by: TRC, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 50mg.
(2R)-2-amino-3-(4-boronophenyl)propanoic acid (CAS 111821-49-9) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 209.01 g/mol. IUPAC name: (2R)-2-amino-3-(4-boronophenyl)propanoic acid. InChIKey: NFIVJOSXJDORSP-MRVPVSSYSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 209.01 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-boronophenyl)propanoic acid |
| InChIKey | NFIVJOSXJDORSP-MRVPVSSYSA-N |
| SMILES | B(C1=CC=C(C=C1)C[C@H](C(=O)O)N)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Borono-D-phenylalanine, (R)-2-amino-3-(4-boronophenyl)propanoic acid, (2R)-2-amino-3-(4-boronophenyl)propanoic acid, D-Phenylalanine, 4-borono-, 4-Borono-D-phenylalanine, >=97.0% (HPLC), (2R)-2-amino-3-[4-(dihydroxyboranyl)phenyl]propanoic acid, d-4-boronophenylalanine, (R)-2-Amino-3-(4-boronophenyl)propanoicacid