CAS 80994-59-8 appears in our catalog under these names: Acetylcysteine Impurity 35, Borofalan(10B)/ 98.67% (existing batch purity), Borofalan (10B). Offered by: Hubei YoungXin, TargetMol, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 500mg.
(2S)-2-amino-3-(4-(10B)boronophenyl)propanoic acid (CAS 80994-59-8) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 208.21 g/mol. IUPAC name: (2S)-2-amino-3-(4-(10B)boronophenyl)propanoic acid. InChIKey: NFIVJOSXJDORSP-ULMHTEDTSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-(10B)boronophenyl)propanoic acid |
| InChIKey | NFIVJOSXJDORSP-ULMHTEDTSA-N |
| SMILES | [10B](C1=CC=C(C=C1)C[C@@H](C(=O)O)N)(O)O |
Computed by PubChem (NCBI)