CAS 875816-94-7 appears in our catalog under these names: 5-Nitrobenzo[c][1,2]oxaborol-1(3H)-ol, 98%, 98%, 5-Nitrobenzo[c][1,2]oxaborol-1(3H)-ol, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-hydroxy-5-nitro-3H-2,1-benzoxaborole (CAS 875816-94-7) is a chemical compound with the molecular formula C7H6BNO4 and a molecular weight of 178.94 g/mol. IUPAC name: 1-hydroxy-5-nitro-3H-2,1-benzoxaborole. InChIKey: VHUKHRCRSXJPFF-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO4 |
|---|---|
| Molecular weight | 178.94 g/mol |
| IUPAC name | 1-hydroxy-5-nitro-3H-2,1-benzoxaborole |
| InChIKey | VHUKHRCRSXJPFF-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)