CAS 710348-42-8 appears in our catalog under these names: 2–oxo–2,3–dihydrobenzooxazole–5–boronic acid, (2,3-dihydro-2-oxo-5-benzoxazolyl)-Boronic acid, 97%, 97%, (2-Oxo-2,3-dihydrobenzo[d]oxazol-5-yl)boronic acid, 98%, (2-Oxo-2,3-dihydrobenzo[d]oxazol-5-yl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
(2-oxo-3H-1,3-benzoxazol-5-yl)boronic acid (CAS 710348-42-8) is a chemical compound with the molecular formula C7H6BNO4 and a molecular weight of 178.94 g/mol. IUPAC name: (2-oxo-3H-1,3-benzoxazol-5-yl)boronic acid. InChIKey: WWGUKCACGZLIHO-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO4 |
|---|---|
| Molecular weight | 178.94 g/mol |
| IUPAC name | (2-oxo-3H-1,3-benzoxazol-5-yl)boronic acid |
| InChIKey | WWGUKCACGZLIHO-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(=O)N2)(O)O |
Computed by PubChem (NCBI)