CAS 1285533-35-8 appears in our catalog under these names: 4-Nitrobenzo[c][1,2]oxaborol-1(3H)-ol, 97%, 97%, 4-NITROBENZO[C][1,2]OXABOROL-1(3H)-OL, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-hydroxy-4-nitro-3H-2,1-benzoxaborole (CAS 1285533-35-8) is a chemical compound with the molecular formula C7H6BNO4 and a molecular weight of 178.94 g/mol. IUPAC name: 1-hydroxy-4-nitro-3H-2,1-benzoxaborole. InChIKey: RTDNSCFUOJSBLZ-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO4 |
|---|---|
| Molecular weight | 178.94 g/mol |
| IUPAC name | 1-hydroxy-4-nitro-3H-2,1-benzoxaborole |
| InChIKey | RTDNSCFUOJSBLZ-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C(=CC=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)