cas: 939533-80-9 — see every product listed under this CAS number, including other names
(2-bromo-4-methyl-phenyl) propanoate, 97% (CAS 939533-80-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1333RH-100mg |
| cas | 939533-80-9 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 621.20 Pln | |
| Chemat | 250mg | 990.80 Pln | |
| Chemat | 500mg | 1360.40 Pln | |
| Chemat | 1g | 1917.20 Pln | |
| Chemat | 5g | 5632.40 Pln | |
| Chemat | 10g | 9347.60 Pln | |
| Chemat | 25g | 18630.80 Pln | |
| Fluorochem | 100mg | 1143.37 Pln | |
| Fluorochem | 250mg | 1830.62 Pln | |
| Fluorochem | 500mg | 2523.09 Pln | |
| Fluorochem | 1g | 3538.36 Pln | |
| Fluorochem | 5g | 10270.36 Pln | |
| Fluorochem | 10g | 17070.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2-bromo-4-methylphenyl) propanoate (CAS 939533-80-9) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: (2-bromo-4-methylphenyl) propanoate. InChIKey: PRPRTIJMLABJHC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | (2-bromo-4-methylphenyl) propanoate |
| InChIKey | PRPRTIJMLABJHC-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC1=C(C=C(C=C1)C)Br |
Computed by PubChem (NCBI)