CAS 939533-80-9 appears in our catalog under these names: 2-Bromo-4-methylphenyl propionate, 97%, (2-bromo-4-methyl-phenyl) propanoate, 97%, 97%, (2-bromo-4-methyl-phenyl) propanoate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g, 25g.
(2-bromo-4-methylphenyl) propanoate (CAS 939533-80-9) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: (2-bromo-4-methylphenyl) propanoate. InChIKey: PRPRTIJMLABJHC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | (2-bromo-4-methylphenyl) propanoate |
| InChIKey | PRPRTIJMLABJHC-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC1=C(C=C(C=C1)C)Br |
Computed by PubChem (NCBI)