CAS 879-52-7 appears in our catalog under these names: Phenyl(1,3-thiazol-2-yl)methanol, 95-<97%, Phenyl(1,3-thiazol-2-yl)methanol, ≥97-<99%, Phenyl(1,3-thiazol-2-yl)methanol. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 0,5g, 50mg.
Phenyl(1,3-thiazol-2-yl)methanol (CAS 879-52-7) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: phenyl(1,3-thiazol-2-yl)methanol. InChIKey: XHPLEXYGTGYCCO-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | phenyl(1,3-thiazol-2-yl)methanol |
| InChIKey | XHPLEXYGTGYCCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=NC=CS2)O |
Computed by PubChem (NCBI)