cas: 26549-65-5 — see every product listed under this CAS number, including other names
(2R,3R)-N,N,N',N'-Tetramethyl-L-tartaric acid diamide, 95%, 95% (CAS 26549-65-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113TNE-1g |
| cas | 26549-65-5 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 491.60 Pln | |
| Chemat | 500g | 2102.40 Pln | |
| Chemat | 1kg | 3434.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,3S)-2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide (CAS 26549-65-5) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide. InChIKey: PCYDYHRBODKVEL-WDSKDSINSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxy-N,N,N',N'-tetramethylbutanediamide |
| InChIKey | PCYDYHRBODKVEL-WDSKDSINSA-N |
| SMILES | CN(C)C(=O)[C@H]([C@@H](C(=O)N(C)C)O)O |
Computed by PubChem (NCBI)