CAS 259825-43-9 appears in our catalog under these names: H-D-Dap(Boc)-OH, 97%, H-D-Dap(Boc)-OH, N-b-Boc-D-2,3-diaminopropionic acid, 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-D-alanine, 97%, 97%, (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 500mg, 2g, 100mg.
(2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 259825-43-9) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZSJIIZWMJVWKIR-RXMQYKEDSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZSJIIZWMJVWKIR-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)