Products 1609395-21-2

CAS 1609395-21-2 is the registry number for 1-(2-Amino-2-oxoethyl)-3-piperidinecarboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(2-amino-2-oxoethyl)piperidine-3-carboxylic acid;hydrate (CAS 1609395-21-2) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: 1-(2-amino-2-oxoethyl)piperidine-3-carboxylic acid;hydrate. InChIKey: NYRFXZSQRTZBFT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16N2O4
Molecular weight204.22 g/mol
IUPAC name1-(2-amino-2-oxoethyl)piperidine-3-carboxylic acid;hydrate
InChIKeyNYRFXZSQRTZBFT-UHFFFAOYSA-N
SMILESC1CC(CN(C1)CC(=O)N)C(=O)O.O

Computed by PubChem (NCBI)