CAS 1523541-98-1 is the registry number for (2R,6R)-2,6-Dimethylpiperazine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(2R,6R)-2,6-dimethylpiperazine;oxalic acid (CAS 1523541-98-1) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2R,6R)-2,6-dimethylpiperazine;oxalic acid. InChIKey: SGDBJISJUXHDLI-KGZKBUQUSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2R,6R)-2,6-dimethylpiperazine;oxalic acid |
| InChIKey | SGDBJISJUXHDLI-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CNC[C@H](N1)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)