CAS 1456883-45-6 is the registry number for ((tert-Butoxycarbonyl)amino)-d-alanine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2R)-2-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]propanoic acid (CAS 1456883-45-6) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2R)-2-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]propanoic acid. InChIKey: QVTGCEJHQKDBSH-RXMQYKEDSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2R)-2-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]propanoic acid |
| InChIKey | QVTGCEJHQKDBSH-RXMQYKEDSA-N |
| SMILES | C[C@H](C(=O)O)NNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)