cas: 118492-87-8 — see every product listed under this CAS number, including other names
(2R,3S)-1-[(tert-Butoxy)carbonyl]-3-hydroxypyrrolidine-2-carboxylic acid, 97%, 97% (CAS 118492-87-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119R5P-100mg |
| cas | 118492-87-8 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 500mg | 741.20 Pln | |
| Chemat | 1g | 1110.80 Pln | |
| Chemat | 5g | 3064.40 Pln | |
| Chemat | 10g | 4792.40 Pln | |
| Chemat | 50g | 13346.00 Pln | |
| Chemat | 100g | 25898.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 118492-87-8) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2R,3S)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JLDHXHPQMBNKMC-NKWVEPMBSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JLDHXHPQMBNKMC-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H]1C(=O)O)O |
Computed by PubChem (NCBI)