cas: 118492-87-8 — see every product listed under this CAS number, including other names
Boc-cis-3-hydroxy-D-proline, 95% (CAS 118492-87-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493581-100MG |
| cas | 118492-87-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 487.35 Pln | |
| Fluorochem | 250mg | 784.12 Pln | |
| Fluorochem | 500mg | 1294.35 Pln | |
| Fluorochem | 1g | 1872.28 Pln | |
| Fluorochem | 5g | 5641.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R,3S)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 118492-87-8) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2R,3S)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JLDHXHPQMBNKMC-NKWVEPMBSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JLDHXHPQMBNKMC-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H]1C(=O)O)O |
Computed by PubChem (NCBI)