cas: 281655-61-6 — see every product listed under this CAS number, including other names
(2S)-2-([(9H-fluoren-9-ylmethoxy)carbonyl]amino)-3-(quinolin-3-yl)propanoic acid, 98% (CAS 281655-61-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692394-50MG |
| cas | 281655-61-6 |
| size | 50mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 388.42 Pln | |
| Fluorochem | 100mg | 487.35 Pln | |
| Fluorochem | 250mg | 981.96 Pln | |
| Fluorochem | 500mg | 1908.72 Pln | |
| Fluorochem | 1g | 2434.58 Pln | |
| Fluorochem | 2.5g | 5995.82 Pln | |
| Fluorochem | 5g | 10056.89 Pln | |
| Fluorochem | 10g | 19256.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-3-ylpropanoic acid (CAS 281655-61-6) is a chemical compound with the molecular formula C27H22N2O4 and a molecular weight of 438.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-3-ylpropanoic acid. InChIKey: HZZZBOUYIXBVNP-VWLOTQADSA-N.
| Molecular formula | C27H22N2O4 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-3-ylpropanoic acid |
| InChIKey | HZZZBOUYIXBVNP-VWLOTQADSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)