CAS 214852-58-1 appears in our catalog under these names: Fmoc-beta-(2-quinolyl)-d-ala-oh, 95%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(quinolin-2-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid (CAS 214852-58-1) is a chemical compound with the molecular formula C27H22N2O4 and a molecular weight of 438.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid. InChIKey: IDOMHXAHHXHYMO-RUZDIDTESA-N.
| Molecular formula | C27H22N2O4 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid |
| InChIKey | IDOMHXAHHXHYMO-RUZDIDTESA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)