CAS 204322-23-6 appears in our catalog under these names: Fmoc-L-1,2,3,4-tetrahydronorharman-3-carboxylic acid, 96%, Fmoc–Tpi–OH, FMOC-L-1,2,3,4-TETRAHYDRONORHARMAN-3-CAR/ 99.66% (existing batch purity), Fmoc-Tpi-OH 98%, Fmoc-L-1,2,3,4-Tetrahydronorharman-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 1g, 25g, 100g, 5g, 5mg, 10mg, 25mg, 50mg.
(3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (CAS 204322-23-6) is a chemical compound with the molecular formula C27H22N2O4 and a molecular weight of 438.5 g/mol. IUPAC name: (3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid. InChIKey: IHHULIKSMJSELI-VWLOTQADSA-N.
| Molecular formula | C27H22N2O4 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | IHHULIKSMJSELI-VWLOTQADSA-N |
| SMILES | C1[C@H](N(CC2=C1C3=CC=CC=C3N2)C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46)C(=O)O |
Computed by PubChem (NCBI)